![2-Azaspiro[4.4]nonan-3-one (CAS: 75751-72-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680704.png "2-Azaspiro[4.4]nonan-3-one chemical structure")
2-Azaspiro[4.4]nonan-3-one
Catalog No: FT-0680704
CAS No: 75751-72-3
- Chemical Name: 2-Azaspiro[4.4]nonan-3-one
- Molecular Formula: C8H13NO
- Molecular Weight: 139.19
- InChI Key: JONWDDCKNVVMBS-UHFFFAOYSA-N
- InChI: InChI=1S/C8H13NO/c10-7-5-8(6-9-7)3-1-2-4-8/h1-6H2,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 139.19500 |
| Density: | 1.08g/cm3 |
| CAS: | 75751-72-3 |
| Bolling_Point: | 318.2ºC at 760 mmHg |
| Product_Name: | 2-Azaspiro[4.4]nonan-3-one |
| Melting_Point: | 66-68ºC |
| Flash_Point: | 183ºC |
| MF: | C8H13NO |
| Density: | 1.08g/cm3 |
|---|---|
| LogP: | 1.39550 |
| Flash_Point: | 183ºC |
| Melting_Point: | 66-68ºC |
| FW: | 139.19500 |
| PSA: | 29.10000 |
| Exact_Mass: | 139.10000 |
| MF: | C8H13NO |
| Bolling_Point: | 318.2ºC at 760 mmHg |
| Refractive_Index: | 1.514 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933790090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-