3-(3-chlorophenyl)propanal
Catalog No: FT-0757973
CAS No: 136415-83-3
- Chemical Name: 3-(3-chlorophenyl)propanal
- Molecular Formula: C9H9ClO
- Molecular Weight: 168.62
- InChI Key: GAMNINPBAOTMLA-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9ClO/c10-9-5-1-3-8(7-9)4-2-6-11/h1,3,5-7H,2,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 136415-83-3 |
|---|---|
| MF: | C9H9ClO |
| Density: | 1.1±0.1 g/cm3 |
| Flash_Point: | 117.1±11.5 °C |
| Melting_Point: | N/A |
| Product_Name: | m-Chloropropiophenone |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 238.6±15.0 °C at 760 mmHg |
| FW: | 168.620 |
| Bolling_Point: | 238.6±15.0 °C at 760 mmHg |
|---|---|
| Density: | 1.1±0.1 g/cm3 |
| MF: | C9H9ClO |
| LogP: | 2.63 |
| Exact_Mass: | 168.034195 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 117.1±11.5 °C |
| FW: | 168.620 |
| Refractive_Index: | 1.527 |
| PSA: | 17.07000 |
| Safety_Statements: | H302-H315-H317-H318-H335 |
|---|---|
| Symbol: | GHS05, GHS07 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| HS_Code: | 2913000090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)