2-AMINO-5,6-DIMETHYL-4-HYDROXYPYRIMIDINE
Catalog No: FT-0611143
CAS No: 3977-23-9
- Chemical Name: 2-AMINO-5,6-DIMETHYL-4-HYDROXYPYRIMIDINE
- Molecular Formula: C6H9N3O
- Molecular Weight: 139.16
- InChI Key: APWRLAZEMYLHKZ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H9N3O/c1-3-4(2)8-6(7)9-5(3)10/h1-2H3,(H3,7,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3977-23-9 |
| Flash_Point: | 110.4ºC |
| Product_Name: | 2-amino-5,6-dimethyl-1H-pyrimidin-4-one |
| Bolling_Point: | 341°C |
| FW: | 139.15500 |
| Melting_Point: | 333-337 °C(lit.) |
| MF: | C6H9N3O |
| Density: | 1.36g/cm3 |
| Refractive_Index: | 1.625 |
|---|---|
| Flash_Point: | 110.4ºC |
| LogP: | 0.96240 |
| Bolling_Point: | 341°C |
| FW: | 139.15500 |
| PSA: | 72.03000 |
| Computational_Chemistry: | ['1. XlogP :-06 ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :17 ', '6. TPSA 675 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :239 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 333-337 °C(lit.) |
| MF: | C6H9N3O |
| Exact_Mass: | 139.07500 |
| Density: | 1.36g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| HS_Code: | 2933599090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)