9-Fluorenylmethyl carbamate
Catalog No: FT-0641956
CAS No: 84418-43-9
- Chemical Name: 9-Fluorenylmethyl carbamate
- Molecular Formula: C15H13NO2
- Molecular Weight: 239.27
- InChI Key: ZZOKVYOCRSMTSS-UHFFFAOYSA-N
- InChI: InChI=1S/C15H13NO2/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H2,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Fmoc-NH2 |
|---|---|
| Flash_Point: | 242.3±16.4 °C |
| Melting_Point: | 201-204ºC |
| FW: | 239.269 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 84418-43-9 |
| Bolling_Point: | 459.7±14.0 °C at 760 mmHg |
| MF: | C15H13NO2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 2.99 |
| Flash_Point: | 242.3±16.4 °C |
| Melting_Point: | 201-204ºC |
| FW: | 239.269 |
| PSA: | 52.32000 |
| Exact_Mass: | 239.094635 |
| MF: | C15H13NO2 |
| Bolling_Point: | 459.7±14.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Refractive_Index: | 1.627 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
| WGK_Germany: | 3 |
| Safety_Statements: | 22-24/25-36/37/39-27-26 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)