(6-BROMO-PYRIDIN-3-YL)-METHANOL
Catalog No: FT-0649974
CAS No: 122306-01-8
- Chemical Name: (6-BROMO-PYRIDIN-3-YL)-METHANOL
- Molecular Formula: C6H6BrNO
- Molecular Weight: 188.02
- InChI Key: QPPDKOIDAYZUHN-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6BrNO/c7-6-2-1-5(4-9)3-8-6/h1-3,9H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 122306-01-8 |
| Flash_Point: | 143.9±23.7 °C |
| Product_Name: | 6-Bromo-3-pyridinemethanol |
| Bolling_Point: | 314.3±27.0 °C at 760 mmHg |
| FW: | 188.022 |
| Melting_Point: | N/A |
| MF: | C6H6BrNO |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.599 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C6H6BrNO |
| Flash_Point: | 143.9±23.7 °C |
| LogP: | 0.35 |
| FW: | 188.022 |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 33.12000 |
| Bolling_Point: | 314.3±27.0 °C at 760 mmHg |
| Exact_Mass: | 186.963272 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)