2-ETHYL-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE-3,5-DIONE
Catalog No: FT-0612233
CAS No: 175136-47-7
- Chemical Name: 2-ETHYL-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE-3,5-DIONE
- Molecular Formula: C11H11NO3
- Molecular Weight: 205.21
- InChI Key: FOYZYIYDHVWEDP-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11NO3/c1-2-8-11(14)12-10(13)7-5-3-4-6-9(7)15-8/h3-6,8H,2H2,1H3,(H,12,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-ethyl-1,4-benzoxazepine-3,5-dione |
|---|---|
| Flash_Point: | 191ºC |
| Melting_Point: | 162ºC |
| FW: | 205.21000 |
| Density: | 1.195g/cm3 |
| CAS: | 175136-47-7 |
| Bolling_Point: | 392.2ºC at 760 mmHg |
| MF: | C11H11NO3 |
| Density: | 1.195g/cm3 |
|---|---|
| LogP: | 1.44280 |
| Flash_Point: | 191ºC |
| Melting_Point: | 162ºC |
| FW: | 205.21000 |
| PSA: | 55.40000 |
| Exact_Mass: | 205.07400 |
| MF: | C11H11NO3 |
| Bolling_Point: | 392.2ºC at 760 mmHg |
| Vapor_Pressure: | 2.33E-06mmHg at 25°C |
| Refractive_Index: | 1.529 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)