![[6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol (CAS: 13411-16-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0773346.png "[6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol chemical structure")
[6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol
Catalog No: FT-0773346
CAS No: 13411-16-0
- Chemical Name: [6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol
- Molecular Formula: C12H10N2O4
- Molecular Weight: 246.22
- InChI Key: JQKHJQJVKRFMCO-SNAWJCMRSA-N
- InChI: InChI=1S/C12H10N2O4/c15-8-10-3-1-2-9(13-10)4-5-11-6-7-12(18-11)14(16)17/h1-7,15H,8H2/b5-4+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 13411-16-0 |
|---|---|
| MF: | C12H10N2O4 |
| Density: | 1.412 g/cm3 |
| Flash_Point: | 205.6ºC |
| Melting_Point: | N/A |
| Product_Name: | [6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol |
| Symbol: | GHS07 |
| Bolling_Point: | 416.3ºC at 760 mmHg |
| FW: | 246.21900 |
| Bolling_Point: | 416.3ºC at 760 mmHg |
|---|---|
| Density: | 1.412 g/cm3 |
| MF: | C12H10N2O4 |
| LogP: | 2.76870 |
| Exact_Mass: | 246.06400 |
| Vapor_Pressure: | 0mmHg at 25°C |
| Flash_Point: | 205.6ºC |
| FW: | 246.21900 |
| Refractive_Index: | 1.695 |
| PSA: | 92.08000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H319 |
| Warning_Statement: | P305 + P351 + P338 |
| RTECS: | UT5023000 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-