![(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid (CAS: 52899-07-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0772801.png "(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid chemical structure")
(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid
Catalog No: FT-0772801
CAS No: 52899-07-7
- Chemical Name: (2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid
- Molecular Formula: C11H20N2O3
- Molecular Weight: 228.29
- InChI Key: ZKQOUHVVXABNDG-IUCAKERBSA-N
- InChI: InChI=1S/C11H20N2O3/c1-7(2)6-9(11(15)16)13-10(14)8-4-3-5-12-8/h7-9,12H,3-6H2,1-2H3,(H,13,14)(H,15,16)/t8-,9-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 457.5ºC at 760 mmHg |
|---|---|
| CAS: | 52899-07-7 |
| MF: | C11H20N2O3 |
| Density: | 1.126g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 4-methyl-2-(pyrrolidine-2-carbonylamino)pentanoic acid |
| Flash_Point: | 230.5ºC |
| FW: | 228.28800 |
| Density: | 1.126g/cm3 |
|---|---|
| MF: | C11H20N2O3 |
| LogP: | 1.07360 |
| Exact_Mass: | 228.14700 |
| Bolling_Point: | 457.5ºC at 760 mmHg |
| Flash_Point: | 230.5ºC |
| FW: | 228.28800 |
| Refractive_Index: | 1.496 |
| PSA: | 78.43000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| WGK_Germany: | 3 |
| RIDADR: | NONH for all modes of transport |
