5-fluoro-2-hydroxy-3-methylbenzaldehyde
Catalog No: FT-0738284
CAS No: 704884-74-2
- Chemical Name: 5-fluoro-2-hydroxy-3-methylbenzaldehyde
- Molecular Formula: C8H7FO2
- Molecular Weight: 154.14
- InChI Key: FDUNAMXDKSETQT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7FO2/c1-5-2-7(9)3-6(4-10)8(5)11/h2-4,11H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 704884-74-2 |
|---|---|
| MF: | C8H7FO2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | 44-49ºC |
| Product_Name: | 5-fluoro-2-hydroxy-3-methylbenzaldehyde |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | N/A |
| FW: | 154.13800 |
| MF: | C8H7FO2 |
|---|---|
| LogP: | 1.65220 |
| Melting_Point: | 44-49ºC |
| Exact_Mass: | 154.04300 |
| PSA: | 37.30000 |
| FW: | 154.13800 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS05, GHS07 |
| Safety_Statements: | 26-36/37/39 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2913000090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 37/38-41-43 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)