![1H-pyrrolo[2,3-b]pyridine-4-carboxamide (CAS: 1086390-83-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0715149.png "1H-pyrrolo[2,3-b]pyridine-4-carboxamide chemical structure")
1H-pyrrolo[2,3-b]pyridine-4-carboxamide
Catalog No: FT-0715149
CAS No: 1086390-83-1
- Chemical Name: 1H-pyrrolo[2,3-b]pyridine-4-carboxamide
- Molecular Formula: C8H7N3O
- Molecular Weight: 161.16
- InChI Key: JLNLMSPUHPBAFQ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7N3O/c9-7(12)5-1-3-10-8-6(5)2-4-11-8/h1-4H,(H2,9,12)(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1086390-83-1 |
|---|---|
| MF: | C8H7N3O |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 1H-Pyrrolo[2,3-b]pyridine-4-carboxamide |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 161.16100 |
| Exact_Mass: | 161.05900 |
|---|---|
| MF: | C8H7N3O |
| LogP: | 1.36210 |
| PSA: | 71.77000 |
| FW: | 161.16100 |
| Safety_Statements: | H302-H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
