![(2S)-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid (CAS: 5874-89-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0701059.png "(2S)-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid chemical structure")
(2S)-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid
Catalog No: FT-0701059
CAS No: 5874-89-5
- Chemical Name: (2S)-2-[[(2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid
- Molecular Formula: C9H17N3O4
- Molecular Weight: 231.25
- InChI Key: BYXHQQCXAJARLQ-SRQIZXRXSA-N
- InChI: InChI=1S/C9H17N3O4/c1-4(10)7(13)11-5(2)8(14)12-6(3)9(15)16/h4-6H,10H2,1-3H3,(H,11,13)(H,12,14)(H,15,16)/t4-,5+,6+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | N/A |
|---|---|
| CAS: | 5874-89-5 |
| MF: | C9H17N3O4 |
| Density: | 1.227 |
| Melting_Point: | N/A |
| Product_Name: | H-D-Ala-Ala-Ala-OH |
| Flash_Point: | N/A |
| FW: | 231.24900 |
| Exact_Mass: | 231.12200 |
|---|---|
| MF: | C9H17N3O4 |
| Density: | 1.227 |
| FW: | 231.24900 |
| PSA: | 121.52000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
