![(3Z)-3-[(3,5-Dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one (CAS: 204005-46-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0688745.png "(3Z)-3-[(3,5-Dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one chemical structure")
(3Z)-3-[(3,5-Dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one
Catalog No: FT-0688745
CAS No: 204005-46-9
- Chemical Name: (3Z)-3-[(3,5-Dimethyl-1H-pyrrol-2-yl)methylene]-1,3-dihydro-2H-indol-2-one
- Molecular Formula: C15H14N2O
- Molecular Weight: 238.28
- InChI Key: WUWDLXZGHZSWQZ-WQLSENKSSA-N
- InChI: InChI=1S/C15H14N2O/c1-9-7-10(2)16-14(9)8-12-11-5-3-4-6-13(11)17-15(12)18/h3-8,16H,1-2H3,(H,17,18)/b12-8-
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 238.285 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 204005-46-9 |
| Bolling_Point: | 481.4±45.0 °C at 760 mmHg |
| Product_Name: | SU5416 |
| Melting_Point: | N/A |
| Flash_Point: | 244.9±28.7 °C |
| MF: | C15H14N2O |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 2.87 |
| Flash_Point: | 244.9±28.7 °C |
| Refractive_Index: | 1.684 |
| FW: | 238.285 |
| PSA: | 44.89000 |
| MF: | C15H14N2O |
| Bolling_Point: | 481.4±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| Exact_Mass: | 238.110611 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
![1-[2-(Trifluormethyl)phenyl]cyclopropanamin (CAS: 886366-53-6) - Related Chemical Product](/static/img/prod_pic/FT-0694330.png "1-[2-(Trifluormethyl)phenyl]cyclopropanamin chemical structure")
![[1,3]thiazolo[5,4-b]pyridin-6-ylmethanol (CAS: 394223-78-0) - Related Chemical Product](/static/img/prod_pic/FT-0702192.png "[1,3]thiazolo[5,4-b]pyridin-6-ylmethanol chemical structure")