2-Iodo-isonicotinic acid methyl ester
Catalog No: FT-0678274
CAS No: 134579-47-8
- Chemical Name: 2-Iodo-isonicotinic acid methyl ester
- Molecular Formula: C7H6INO2
- Molecular Weight: 263.03
- InChI Key: XXOKMYMXDALOEN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6INO2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 134579-47-8 |
| Flash_Point: | 138.6ºC |
| Product_Name: | 2-Iodo-isonicotinic acid methyl ester |
| Bolling_Point: | 305.6ºC at 760mmHg |
| FW: | 263.03300 |
| Melting_Point: | N/A |
| MF: | C7H6INO2 |
| Density: | 1.844g/cm3 |
| Refractive_Index: | 1.603 |
|---|---|
| Vapor_Pressure: | 0.000812mmHg at 25°C |
| MF: | C7H6INO2 |
| Flash_Point: | 138.6ºC |
| LogP: | 1.47280 |
| FW: | 263.03300 |
| Density: | 1.844g/cm3 |
| PSA: | 39.19000 |
| Bolling_Point: | 305.6ºC at 760mmHg |
| Exact_Mass: | 262.94400 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)