![[(2E,6Z)-nona-2,6-dienyl] acetate (CAS: 68555-65-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0770418.png "[(2E,6Z)-nona-2,6-dienyl] acetate chemical structure")
[(2E,6Z)-nona-2,6-dienyl] acetate
Catalog No: FT-0770418
CAS No: 68555-65-7
- Chemical Name: [(2E,6Z)-nona-2,6-dienyl] acetate
- Molecular Formula: C11H18O2
- Molecular Weight: 182.26
- InChI Key: UHONGPVFPQQOSO-FTGFODROSA-N
- InChI: InChI=1S/C11H18O2/c1-3-4-5-6-7-8-9-10-13-11(2)12/h4-5,8-9H,3,6-7,10H2,1-2H3/b5-4-,9-8+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 182.25900 |
| CAS: | 68555-65-7 |
| MF: | C11H18O2 |
| Flash_Point: | 93.6ºC |
| Product_Name: | [(2E,6Z)-nona-2,6-dienyl] acetate |
| Bolling_Point: | 247.4ºC at 760mmHg |
| Density: | 0.907g/cm3 |
| FW: | 182.25900 |
|---|---|
| Refractive_Index: | 1.459 |
| MF: | C11H18O2 |
| Exact_Mass: | 182.13100 |
| LogP: | 2.85210 |
| Bolling_Point: | 247.4ºC at 760mmHg |
| Density: | 0.907g/cm3 |
| PSA: | 26.30000 |
| Flash_Point: | 93.6ºC |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-