7-Fluoro-[1,8]naphthyridin-2-ol
Catalog No: FT-0678009
CAS No: 846033-37-2
- Chemical Name: 7-Fluoro-[1,8]naphthyridin-2-ol
- Molecular Formula: C8H5FN2O
- Molecular Weight: 164.14
- InChI Key: FUBNBYAEJAJCBT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5FN2O/c9-6-3-1-5-2-4-7(12)11-8(5)10-6/h1-4H,(H,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 164.13700 |
| Density: | 1.373g/cm3 |
| CAS: | 846033-37-2 |
| Bolling_Point: | 376.1ºC at 760 mmHg |
| Product_Name: | 7-fluoro-1H-1,8-naphthyridin-2-one |
| Melting_Point: | 280-281ºC |
| Flash_Point: | 181.3ºC |
| MF: | C8H5FN2O |
| Density: | 1.373g/cm3 |
|---|---|
| LogP: | 1.47450 |
| Flash_Point: | 181.3ºC |
| Melting_Point: | 280-281ºC |
| FW: | 164.13700 |
| PSA: | 46.01000 |
| Exact_Mass: | 164.03900 |
| MF: | C8H5FN2O |
| Bolling_Point: | 376.1ºC at 760 mmHg |
| Refractive_Index: | 1.576 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)