ERB 041
Catalog No: FT-0667949
CAS No: 524684-52-4
- Chemical Name: ERB 041
- Molecular Formula: C15H10FNO3
- Molecular Weight: 271.24
- InChI Key: MQIMZDXIAHJKQP-UHFFFAOYSA-N
- InChI: InChI=1S/C15H10FNO3/c1-2-8-5-10(18)7-12-14(8)20-15(17-12)9-3-4-13(19)11(16)6-9/h2-7,18-19H,1H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 524684-52-4 |
| Flash_Point: | 226.9±28.7 °C |
| Product_Name: | Prinaberel |
| Bolling_Point: | 451.6±45.0 °C at 760 mmHg |
| FW: | 271.243 |
| Melting_Point: | 250-252ºC |
| MF: | C15H10FNO3 |
| Density: | 1.4±0.1 g/cm3 |
| Melting_Point: | 250-252ºC |
|---|---|
| Refractive_Index: | 1.695 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C15H10FNO3 |
| Flash_Point: | 226.9±28.7 °C |
| LogP: | 3.97 |
| FW: | 271.243 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 66.49000 |
| Bolling_Point: | 451.6±45.0 °C at 760 mmHg |
| Exact_Mass: | 271.064484 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)