5,7-Difluoro-2,3-dihydroinden-1-one
Catalog No: FT-0660180
CAS No: 84315-25-3
- Chemical Name: 5,7-Difluoro-2,3-dihydroinden-1-one
- Molecular Formula: C9H6F2O
- Molecular Weight: 168.14
- InChI Key: XWZGNWCKXLECBO-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6F2O/c10-6-3-5-1-2-8(12)9(5)7(11)4-6/h3-4H,1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 168.140 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 84315-25-3 |
| Bolling_Point: | 252.0±40.0 °C at 760 mmHg |
| Product_Name: | 5,7-Difluoro-1-indanone |
| Melting_Point: | 80-84ºC |
| Flash_Point: | 95.9±21.5 °C |
| MF: | C9H6F2O |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.24 |
| Flash_Point: | 95.9±21.5 °C |
| Melting_Point: | 80-84ºC |
| FW: | 168.140 |
| PSA: | 17.07000 |
| Exact_Mass: | 168.038666 |
| MF: | C9H6F2O |
| Bolling_Point: | 252.0±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.537 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | 26-36/37-61 |
| Symbol: | Warning |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914700090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)