N-(5-amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidinamine
Catalog No: FT-0655675
CAS No: 152460-10-1
- Chemical Name: N-(5-amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidinamine
- Molecular Formula: C16H15N5
- Molecular Weight: 277.32
- InChI Key: QGAIPGVQJVGBIA-UHFFFAOYSA-N
- InChI: InChI=1S/C16H15N5/c1-11-4-5-13(17)9-15(11)21-16-19-8-6-14(20-16)12-3-2-7-18-10-12/h2-10H,17H2,1H3,(H,19,20,21)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine |
|---|---|
| Flash_Point: | 278.8±32.9 °C |
| Melting_Point: | 133-1350C |
| FW: | 277.324 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 152460-10-1 |
| Bolling_Point: | 537.3±60.0 °C at 760 mmHg |
| MF: | C16H15N5 |
| Molecular_Structure: | ['1. Molar refractive index 8355 ', '2. Molar volume 2189 ', '3. Parachor (902K)6198 ', '4. Surface tension 642 ', '5. Polarizability 3312'] |
|---|---|
| LogP: | 1.68 |
| Flash_Point: | 278.8±32.9 °C |
| Refractive_Index: | 1.688 |
| FW: | 277.324 |
| Density: | 1.3±0.1 g/cm3 |
| Bolling_Point: | 537.3±60.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :24 ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :3 ', '5. Isotope Atom Count :3 ', '6. TPSA 767 ', '7. Heavy Atom Count :21 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :324 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 133-1350C |
| PSA: | 76.72000 |
| MF: | C16H15N5 |
| More_Info: | ['1. Melting point(°C)145'] |
| Vapor_Pressure: | 0.0±1.4 mmHg at 25°C |
| Exact_Mass: | 277.132751 |
| Hazard_Codes: | Xn,Xi |
|---|---|
| RIDADR: | 3334 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . R22:Harmful if swallowed. |
| HS_Code: | 2934999090 |
| Safety_Statements: | S37/39-S26-S36/37/39 |