CAMYLOFIN
Catalog No: FT-0623437
CAS No: 54-30-8
- Chemical Name: CAMYLOFIN
- Molecular Formula: C19H32N2O2
- Molecular Weight: 320.5
- InChI Key: RYOOHIUJEJZCFT-UHFFFAOYSA-N
- InChI: InChI=1S/C19H32N2O2/c1-5-21(6-2)14-13-20-18(17-10-8-7-9-11-17)19(22)23-15-12-16(3)4/h7-11,16,18,20H,5-6,12-15H2,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 320.47000 |
| Density: | 0.987g/cm3 |
| CAS: | 54-30-8 |
| Bolling_Point: | 408.4ºC at 760mmHg |
| Product_Name: | Camylofine |
| Melting_Point: | N/A |
| Flash_Point: | 200.8ºC |
| MF: | C19H32N2O2 |
| Density: | 0.987g/cm3 |
|---|---|
| LogP: | 3.63930 |
| Flash_Point: | 200.8ºC |
| Refractive_Index: | 1.502 |
| FW: | 320.47000 |
| PSA: | 41.57000 |
| MF: | C19H32N2O2 |
| Bolling_Point: | 408.4ºC at 760mmHg |
| Exact_Mass: | 320.24600 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | MB9625000 |
| Risk_Statements(EU): | 22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| HS_Code: | 2922499990 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)