1,10-PHENANTHROLINIUM CHLORIDE MONOHYDRATE
Catalog No: FT-0606039
CAS No: 18851-33-7
- Molecular Formula: 234.68
- Formula Weight: C12H11ClN2O
- Inchl Key: NDLHUHRGAIHALB-UHFFFAOYSA-N
- Inchl: InChI=1S/C12H8N2.ClH.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;/h1-8H;1H;1H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 234.68200 |
| Density: | N/A |
| CAS: | 18851-33-7 |
| Bolling_Point: | 365.1ºC at 760 mmHg |
| Product_Name: | 1,10-phenanthrolinium chloride monohydrate |
| Melting_Point: | 224-225ºC |
| Flash_Point: | 164.8ºC |
| MF: | C12H11ClN2O |
| LogP: | 3.52070 |
|---|---|
| Flash_Point: | 164.8ºC |
| Melting_Point: | 224-225ºC |
| FW: | 234.68200 |
| PSA: | 35.01000 |
| MF: | C12H11ClN2O |
| Bolling_Point: | 365.1ºC at 760 mmHg |
| Vapor_Pressure: | 3.38E-05mmHg at 25°C |
| Exact_Mass: | 234.05600 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
| Risk_Statements(EU): | R25 |
| Safety_Statements: | 45-60-61 |
| Symbol: | Danger |
| Warning_Statement: | P273-P301 + P310-P501 |
| RIDADR: | UN 2811 6.1/PG 3 |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)