1-(4-METHYLPHENYL)-1H-PYRROLE-2,5-DIONE
Catalog No: FT-0605752
CAS No: 1631-28-3
- Chemical Name: 1-(4-METHYLPHENYL)-1H-PYRROLE-2,5-DIONE
- Molecular Formula: C11H9NO2
- Molecular Weight: 187.19
- InChI Key: KCFXNGDHQPMIAQ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H9NO2/c1-8-2-4-9(5-3-8)12-10(13)6-7-11(12)14/h2-7H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(4-methylphenyl)-1h-pyrrole-2,5-dione |
|---|---|
| Bolling_Point: | 333.2ºC at 760mmHg |
| Density: | 1.277g/cm3 |
| MF: | C11H9NO2 |
| CAS: | 1631-28-3 |
| Melting_Point: | N/A |
| Flash_Point: | 154.2ºC |
| FW: | 187.19500 |
| Exact_Mass: | 187.06300 |
|---|---|
| Vapor_Pressure: | 0.000139mmHg at 25°C |
| MF: | C11H9NO2 |
| LogP: | 1.48940 |
| Bolling_Point: | 333.2ºC at 760mmHg |
| Density: | 1.277g/cm3 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 374 ', '7. Heavy Atom Count :14 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :270 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| PSA: | 37.38000 |
| FW: | 187.19500 |
| Flash_Point: | 154.2ºC |
| Refractive_Index: | 1.615 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2925190090 |