![Methyl 4'-bromo[1,1'-biphenyl]-4-carboxylate (CAS: 89901-03-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680234.png "Methyl 4'-bromo[1,1'-biphenyl]-4-carboxylate chemical structure")
Methyl 4'-bromo[1,1'-biphenyl]-4-carboxylate
Catalog No: FT-0680234
CAS No: 89901-03-1
- Chemical Name: Methyl 4'-bromo[1,1'-biphenyl]-4-carboxylate
- Molecular Formula: C14H11BrO2
- Molecular Weight: 291.14
- InChI Key: JHNMJLKCONRGMK-UHFFFAOYSA-N
- InChI: InChI=1S/C14H11BrO2/c1-17-14(16)12-4-2-10(3-5-12)11-6-8-13(15)9-7-11/h2-9H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Methyl 4'-bromo-4-biphenylcarboxylate |
|---|---|
| Bolling_Point: | 382.7±25.0 °C at 760 mmHg |
| MF: | C14H11BrO2 |
| Symbol: | GHS05, GHS09 |
| Melting_Point: | 146-148ºC |
| CAS: | 89901-03-1 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 291.140 |
| Flash_Point: | 185.3±23.2 °C |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
|---|---|
| Exact_Mass: | 289.994232 |
| Refractive_Index: | 1.588 |
| LogP: | 4.75 |
| Bolling_Point: | 382.7±25.0 °C at 760 mmHg |
| Density: | 1.4±0.1 g/cm3 |
| MF: | C14H11BrO2 |
| PSA: | 26.30000 |
| FW: | 291.140 |
| Flash_Point: | 185.3±23.2 °C |
| Melting_Point: | 146-148ºC |
| Risk_Statements(EU): | 36/37/38 |
|---|---|
| HS_Code: | 2916399090 |
| Safety_Statements: | 26-36/37/39 |
| Warning_Statement: | P273-P280-P305 + P351 + P338-P501 |
| Symbol: | GHS05, GHS09 |
| RIDADR: | UN 3077 9 / PGIII |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)