2,6-Difluoro-3-methoxybenzeneboronic acid
Catalog No: FT-0651946
CAS No: 870779-02-5
- Chemical Name: 2,6-Difluoro-3-methoxybenzeneboronic acid
- Molecular Formula: C7H7BF2O3
- Molecular Weight: 187.94
- InChI Key: WSRQWTCBDHWVGY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7BF2O3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3,11-12H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,6-Difluoro-3-methoxyphenylboronic acid |
|---|---|
| Flash_Point: | 155ºC |
| Melting_Point: | 112-114ºC |
| FW: | 187.93600 |
| Density: | 1.35g/cm3 |
| CAS: | 870779-02-5 |
| Bolling_Point: | 332.7ºC at 760 mmHg |
| MF: | C7H7BF2O3 |
| Density: | 1.35g/cm3 |
|---|---|
| Flash_Point: | 155ºC |
| Melting_Point: | 112-114ºC |
| FW: | 187.93600 |
| PSA: | 49.69000 |
| Exact_Mass: | 188.04600 |
| MF: | C7H7BF2O3 |
| Bolling_Point: | 332.7ºC at 760 mmHg |
| Refractive_Index: | 1.485 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2931900090 |
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)