3-HYDROXY-5-NITROBENZOIC ACID
Catalog No: FT-0660269
CAS No: 78238-14-9
- Molecular Formula: 183.12
- Formula Weight: C7H5NO5
- Inchl Key: ZVLLYIMPDTXFNC-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H5NO5/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,9H,(H,10,11)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 183.118 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 78238-14-9 |
| Bolling_Point: | 423.5±40.0 °C at 760 mmHg |
| Product_Name: | 3-Hydroxy-5-nitrobenzoic acid |
| Melting_Point: | 190-195ºC |
| Flash_Point: | 195.3±15.8 °C |
| MF: | C7H5NO5 |
| Density: | 1.6±0.1 g/cm3 |
|---|---|
| LogP: | 2.14 |
| Flash_Point: | 195.3±15.8 °C |
| Melting_Point: | 190-195ºC |
| FW: | 183.118 |
| PSA: | 103.35000 |
| Exact_Mass: | 183.016769 |
| MF: | C7H5NO5 |
| Bolling_Point: | 423.5±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Refractive_Index: | 1.664 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918290000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)