4-Methyl-1-phenyl-2-pentanone
Catalog No: FT-0658153
CAS No: 5349-62-2
- Chemical Name: 4-Methyl-1-phenyl-2-pentanone
- Molecular Formula: C12H16O
- Molecular Weight: 176.25
- InChI Key: DTYGTEGDVPAKDA-UHFFFAOYSA-N
- InChI: InChI=1S/C12H16O/c1-10(2)8-12(13)9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 250-251ºC |
|---|---|
| MF: | C12H16O |
| Density: | 0.949 |
| FW: | 176.25500 |
| Product_Name: | 4-methyl-1-phenylpentan-2-one |
| CAS: | 5349-62-2 |
| Flash_Point: | 105ºC |
| Melting_Point: | N/A |
| Bolling_Point: | 250-251ºC |
|---|---|
| MF: | C12H16O |
| Density: | 0.949 |
| Refractive_Index: | 1.498 |
| Exact_Mass: | 176.12000 |
| PSA: | 17.07000 |
| LogP: | 2.84430 |
| Flash_Point: | 105ºC |
| FW: | 176.25500 |
| HS_Code: | 2914399090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Personal_Protective_Equipment: | Eyeshields;Gloves |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)