2-Amino-6-fluoropyridine
Catalog No: FT-0633691
CAS No: 1597-32-6
- Chemical Name: 2-Amino-6-fluoropyridine
- Molecular Formula: C5H5FN2
- Molecular Weight: 112.1
- InChI Key: UZALKVXCOUSWSL-UHFFFAOYSA-N
- InChI: InChI=1S/C5H5FN2/c6-4-2-1-3-5(7)8-4/h1-3H,(H2,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 112.105 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 1597-32-6 |
| Bolling_Point: | 225.0±20.0 °C at 760 mmHg |
| Product_Name: | 6-Fluoro-2-pyridinamine |
| Melting_Point: | 59-61ºC |
| Flash_Point: | 89.9±21.8 °C |
| MF: | C5H5FN2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.13 |
| Flash_Point: | 89.9±21.8 °C |
| Melting_Point: | 59-61ºC |
| FW: | 112.105 |
| PSA: | 38.91000 |
| Exact_Mass: | 112.043678 |
| MF: | C5H5FN2 |
| Bolling_Point: | 225.0±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Refractive_Index: | 1.554 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)