Methyl 6-fluoropicolinate
Catalog No: FT-0656552
CAS No: 455-71-0
- Chemical Name: Methyl 6-fluoropicolinate
- Molecular Formula: C7H6FNO2
- Molecular Weight: 155.13
- InChI Key: NMRCOWOPRPIBPQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6FNO2/c1-11-7(10)5-3-2-4-6(8)9-5/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 155.126 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 455-71-0 |
| Bolling_Point: | 246.0±25.0 °C at 760 mmHg |
| Product_Name: | Methyl 6-fluoropicolinate |
| Melting_Point: | 51-55ºC |
| Flash_Point: | 102.6±23.2 °C |
| MF: | C7H6FNO2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 0.82 |
| Flash_Point: | 102.6±23.2 °C |
| Melting_Point: | 51-55ºC |
| FW: | 155.126 |
| PSA: | 39.19000 |
| Exact_Mass: | 155.038254 |
| MF: | C7H6FNO2 |
| Bolling_Point: | 246.0±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.491 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)