2,3,5,6-Tetrafluorobenzyl alcohol
Catalog No: FT-0609428
CAS No: 4084-38-2
- Chemical Name: 2,3,5,6-Tetrafluorobenzyl alcohol
- Molecular Formula: C7H4F4O
- Molecular Weight: 180.1
- InChI Key: AGWVQASYTKCTCC-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4F4O/c8-4-1-5(9)7(11)3(2-12)6(4)10/h1,12H,2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 180.100 |
|---|---|
| CAS: | 4084-38-2 |
| Melting_Point: | 32-38 °C |
| Bolling_Point: | 178.2±35.0 °C at 760 mmHg |
| MF: | C7H4F4O |
| Product_Name: | 2,3,5,6-tetrafluorobenyl alcohol |
| Flash_Point: | 61.6±25.9 °C |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 180.100 |
|---|---|
| MF: | C7H4F4O |
| Refractive_Index: | 1.457 |
| Bolling_Point: | 178.2±35.0 °C at 760 mmHg |
| Exact_Mass: | 180.019821 |
| PSA: | 20.23000 |
| Computational_Chemistry: | ['1. XlogP :14 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 202 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :140 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Vapor_Pressure: | 0.7±0.4 mmHg at 25°C |
| LogP: | 1.27 |
| Melting_Point: | 32-38 °C |
| Flash_Point: | 61.6±25.9 °C |
| Density: | 1.5±0.1 g/cm3 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 2906299090 |
| Safety_Statements: | S37/39-S26 |