4-CYANO-7-AZAINDOLE
Catalog No: FT-0647073
CAS No: 344327-11-3
- Chemical Name: 4-CYANO-7-AZAINDOLE
- Molecular Formula: C8H5N3
- Molecular Weight: 143.15
- InChI Key: HAROKQXDLYCEQV-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5N3/c9-5-6-1-3-10-8-7(6)2-4-11-8/h1-4H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 143.145 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 344327-11-3 |
| Bolling_Point: | N/A |
| Product_Name: | 4-Cyano-7-azaindole |
| Melting_Point: | 195-197ºC |
| Flash_Point: | N/A |
| MF: | C8H5N3 |
| Melting_Point: | 195-197ºC |
|---|---|
| Density: | 1.3±0.1 g/cm3 |
| LogP: | 2.60 |
| Refractive_Index: | 1.685 |
| FW: | 143.145 |
| PSA: | 52.47000 |
| MF: | C8H5N3 |
| Exact_Mass: | 143.048340 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R37/38;R41 |
| Safety_Statements: | S26-S39 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)