2-(2-CHLORO-4-FLUOROPHENYL)-N'-HYDROXYETHANIMIDAMIDE
Catalog No: FT-0608442
CAS No: 306937-33-7
- Chemical Name: 2-(2-CHLORO-4-FLUOROPHENYL)-N'-HYDROXYETHANIMIDAMIDE
- Molecular Formula: C8H8ClFN2O
- Molecular Weight: 202.61
- InChI Key: ZRXMHYFYQBAPGT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8ClFN2O/c9-7-4-6(10)2-1-5(7)3-8(11)12-13/h1-2,4,13H,3H2,(H2,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(2-Chloro-4-fluoro-phenyl)-N-hydroxy-acetamidine |
|---|---|
| Flash_Point: | 174.4ºC |
| Melting_Point: | 146ºC |
| FW: | 202.61300 |
| Density: | 1.4g/cm3 |
| CAS: | 306937-33-7 |
| Bolling_Point: | 364.8ºC at 760mmHg |
| MF: | C8H8ClFN2O |
| Density: | 1.4g/cm3 |
|---|---|
| LogP: | 2.46830 |
| Flash_Point: | 174.4ºC |
| Melting_Point: | 146ºC |
| FW: | 202.61300 |
| PSA: | 58.61000 |
| Exact_Mass: | 202.03100 |
| MF: | C8H8ClFN2O |
| Bolling_Point: | 364.8ºC at 760mmHg |
| Refractive_Index: | 1.569 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| HS_Code: | 2925290090 |
| Safety_Statements: | 26-36/37/39 |