4-Azaindole
Catalog No: FT-0601479
CAS No: 272-49-1
- Chemical Name: 4-Azaindole
- Molecular Formula: C7H6N2
- Molecular Weight: 118.14
- InChI Key: XWIYUCRMWCHYJR-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N2/c1-2-6-7(8-4-1)3-5-9-6/h1-5,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 272-49-1 |
| Flash_Point: | 124.8±11.1 °C |
| Product_Name: | 4-Azaindole |
| Bolling_Point: | 273.8±13.0 °C at 760 mmHg |
| FW: | 118.136 |
| Melting_Point: | 126-127ºC |
| MF: | C7H6N2 |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.697 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 124.8±11.1 °C |
| LogP: | 0.78 |
| Bolling_Point: | 273.8±13.0 °C at 760 mmHg |
| FW: | 118.136 |
| PSA: | 28.68000 |
| Melting_Point: | 126-127ºC |
| MF: | C7H6N2 |
| Exact_Mass: | 118.053101 |
| Density: | 1.2±0.1 g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 29339980 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)