1-[2-HYDROXY-6-(ISOPENTYLOXY)PHENYL]ETHAN-1-ONE
Catalog No: FT-0607100
CAS No: 249278-25-9
- Chemical Name: 1-[2-HYDROXY-6-(ISOPENTYLOXY)PHENYL]ETHAN-1-ONE
- Molecular Formula: C13H18O3
- Molecular Weight: 222.28
- InChI Key: KFBRVHJODGMLFK-UHFFFAOYSA-N
- InChI: InChI=1S/C13H18O3/c1-9(2)7-8-16-12-6-4-5-11(15)13(12)10(3)14/h4-6,9,15H,7-8H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
|---|---|
| Flash_Point: | 118.2ºC |
| Melting_Point: | 25-27ºC |
| FW: | 222.28000 |
| Density: | 1.059g/cm3 |
| CAS: | 249278-25-9 |
| Bolling_Point: | 328ºC at 760mmHg |
| MF: | C13H18O3 |
| Density: | 1.059g/cm3 |
|---|---|
| LogP: | 3.01970 |
| Flash_Point: | 118.2ºC |
| Melting_Point: | 25-27ºC |
| FW: | 222.28000 |
| PSA: | 46.53000 |
| Exact_Mass: | 222.12600 |
| MF: | C13H18O3 |
| Bolling_Point: | 328ºC at 760mmHg |
| Vapor_Pressure: | 0.000102mmHg at 25°C |
| Refractive_Index: | 1.515 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)