2-Bromo-4-chloropyridine
Catalog No: FT-0648116
CAS No: 22918-01-0
- Chemical Name: 2-Bromo-4-chloropyridine
- Molecular Formula: C5H3BrClN
- Molecular Weight: 192.44
- InChI Key: SURKZMFXICWLHU-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3BrClN/c6-5-3-4(7)1-2-8-5/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 22918-01-0 |
| Flash_Point: | 90.9±21.8 °C |
| Product_Name: | 2-Chloro-4-bromopyridine |
| Bolling_Point: | 226.6±20.0 °C at 760 mmHg |
| FW: | 192.441 |
| Melting_Point: | N/A |
| MF: | C5H3BrClN |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.581 |
|---|---|
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| MF: | C5H3BrClN |
| Flash_Point: | 90.9±21.8 °C |
| LogP: | 2.16 |
| FW: | 192.441 |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 12.89000 |
| Bolling_Point: | 226.6±20.0 °C at 760 mmHg |
| Exact_Mass: | 190.913727 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)