1-(2-CHLOROPHENYL)-2-NITROPROPENE
Catalog No: FT-0607581
CAS No: 18982-43-9
- Chemical Name: 1-(2-CHLOROPHENYL)-2-NITROPROPENE
- Molecular Formula: C9H8ClNO2
- Molecular Weight: 197.62
- InChI Key: FCXHCITVQOIVMI-VOTSOKGWSA-N
- InChI: InChI=1S/C9H8ClNO2/c1-7(11(12)13)6-8-4-2-3-5-9(8)10/h2-6H,1H3/b7-6+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(2-chlorophenyl)-2-nitropropene |
|---|---|
| Flash_Point: | 135.7ºC |
| Melting_Point: | 41ºC |
| FW: | 197.61800 |
| Density: | 1.275g/cm3 |
| CAS: | 18982-43-9 |
| Bolling_Point: | 300.7ºC at 760mmHg |
| MF: | C9H8ClNO2 |
| Density: | 1.275g/cm3 |
|---|---|
| LogP: | 3.50070 |
| Flash_Point: | 135.7ºC |
| Melting_Point: | 41ºC |
| FW: | 197.61800 |
| PSA: | 45.82000 |
| Exact_Mass: | 197.02400 |
| MF: | C9H8ClNO2 |
| Bolling_Point: | 300.7ºC at 760mmHg |
| Vapor_Pressure: | 0.00197mmHg at 25°C |
| Refractive_Index: | 1.598 |