4-CHLOROPHENYL 2-HYDROXYETHYL SULPHIDE
Catalog No: FT-0608630
CAS No: 13457-98-2
- Chemical Name: 4-CHLOROPHENYL 2-HYDROXYETHYL SULPHIDE
- Molecular Formula: C8H9ClOS
- Molecular Weight: 188.67
- InChI Key: HHIWVLZQIJUIPJ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9ClOS/c9-7-1-3-8(4-2-7)11-6-5-10/h1-4,10H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 13457-98-2 |
| MF: | C8H9ClOS |
| Flash_Point: | 138.1ºC |
| Product_Name: | 2-(4-chlorophenyl)sulfanylethanol |
| Density: | 1.29 g/cm3 |
| FW: | 188.67400 |
| Bolling_Point: | 304.8ºC at 760 mmHg |
| Refractive_Index: | 1.608 |
|---|---|
| Vapor_Pressure: | 0.000375mmHg at 25°C |
| MF: | C8H9ClOS |
| Flash_Point: | 138.1ºC |
| LogP: | 2.42440 |
| FW: | 188.67400 |
| Density: | 1.29 g/cm3 |
| PSA: | 45.53000 |
| Bolling_Point: | 304.8ºC at 760 mmHg |
| Exact_Mass: | 188.00600 |
| Safety_Statements: | S36/37 |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R20/21/22 |