![Ethyl 2-chloro-2-[2-(4-chloro-2-nitrophenyl)-hydrazono]acetate (CAS: 112091-27-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680182.png "Ethyl 2-chloro-2-[2-(4-chloro-2-nitrophenyl)-hydrazono]acetate chemical structure")
Ethyl 2-chloro-2-[2-(4-chloro-2-nitrophenyl)-hydrazono]acetate
Catalog No: FT-0680182
CAS No: 112091-27-7
- Chemical Name: Ethyl 2-chloro-2-[2-(4-chloro-2-nitrophenyl)-hydrazono]acetate
- Molecular Formula: C10H9Cl2N3O4
- Molecular Weight: 306.10
- InChI Key: ALNGIPRGCSMJCK-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9Cl2N3O4/c1-2-19-10(16)9(12)14-13-7-4-3-6(11)5-8(7)15(17)18/h3-5,13H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | ethyl 2-chloro-2-[(4-chloro-2-nitrophenyl)hydrazinylidene]acetate |
|---|---|
| Flash_Point: | 192.3ºC |
| Melting_Point: | 104-105ºC |
| FW: | 306.10200 |
| Density: | 1.51g/cm3 |
| CAS: | 112091-27-7 |
| Bolling_Point: | 394.3ºC at 760mmHg |
| MF: | C10H9Cl2N3O4 |
| Density: | 1.51g/cm3 |
|---|---|
| LogP: | 3.37170 |
| Flash_Point: | 192.3ºC |
| Melting_Point: | 104-105ºC |
| FW: | 306.10200 |
| PSA: | 96.51000 |
| Exact_Mass: | 304.99700 |
| MF: | C10H9Cl2N3O4 |
| Bolling_Point: | 394.3ºC at 760mmHg |
| Vapor_Pressure: | 1.99E-06mmHg at 25°C |
| Refractive_Index: | 1.601 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2928000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)