![5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine (CAS: 1015610-23-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678352.png "5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine chemical structure")
5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0678352
CAS No: 1015610-23-7
- Chemical Name: 5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C7H4FIN2
- Molecular Weight: 262.02
- InChI Key: ZTZNXOHCFQLAGN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4FIN2/c8-5-3-11-7-4(6(5)9)1-2-10-7/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 262.023 |
| Density: | 2.2±0.1 g/cm3 |
| CAS: | 1015610-23-7 |
| Bolling_Point: | 363.1±37.0 °C at 760 mmHg |
| Product_Name: | 5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 173.4±26.5 °C |
| MF: | C7H4FIN2 |
| Density: | 2.2±0.1 g/cm3 |
|---|---|
| LogP: | 3.05 |
| Flash_Point: | 173.4±26.5 °C |
| Refractive_Index: | 1.751 |
| FW: | 262.023 |
| PSA: | 28.68000 |
| MF: | C7H4FIN2 |
| Bolling_Point: | 363.1±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 261.940308 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
