(2-Aminophenyl)boronic acid hydrochloride (1:1)
Catalog No: FT-0687592
CAS No: 863753-30-4
- Molecular Formula: 173.41
- Formula Weight: C6H9BClNO2
- Inchl Key: WPDASZCYRKGSTO-UHFFFAOYSA-N
- Inchl: InChI=1S/C6H8BNO2.ClH/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,9-10H,8H2;1H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 173.405 |
| Density: | N/A |
| CAS: | 863753-30-4 |
| Bolling_Point: | 346.9ºC at 760 mmHg |
| Product_Name: | (2-Aminophenyl)boronic acid hydrochloride (1:1) |
| Melting_Point: | 115-118ºC |
| Flash_Point: | 163.6ºC |
| MF: | C6H9BClNO2 |
| LogP: | 0.33180 |
|---|---|
| Flash_Point: | 163.6ºC |
| Melting_Point: | 115-118ºC |
| FW: | 173.405 |
| PSA: | 66.48000 |
| MF: | C6H9BClNO2 |
| Bolling_Point: | 346.9ºC at 760 mmHg |
| Exact_Mass: | 173.041489 |
| Hazard_Codes: | Xn |
|---|---|
| Risk_Statements(EU): | R22 |
| Safety_Statements: | S22-S24/25 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)