![(8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2,3,16,17-tetrol (CAS: 1232-80-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0774437.png "(8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2,3,16,17-tetrol chemical structure")
(8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2,3,16,17-tetrol
Catalog No: FT-0774437
CAS No: 1232-80-0
- Chemical Name: (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2,3,16,17-tetrol
- Molecular Formula: C18H24O4
- Molecular Weight: 304.4
- InChI Key: ZUGCDOZAVASBQT-SLVREZFOSA-N
- InChI: InChI=1S/C18H24O4/c1-18-5-4-10-11(13(18)8-16(21)17(18)22)3-2-9-6-14(19)15(20)7-12(9)10/h6-7,10-11,13,16-17,19-22H,2-5,8H2,1H3/t10-,11+,13-,16+,17-,18-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS08 |
|---|---|
| CAS: | 1232-80-0 |
| Flash_Point: | 238.4ºC |
| Product_Name: | 2-Hydroxyestriol |
| Bolling_Point: | 504.6ºC at 760 mmHg |
| FW: | 304.38100 |
| Melting_Point: | N/A |
| MF: | C18H24O4 |
| Density: | 1.334 g/cm3 |
| FW: | 304.38100 |
|---|---|
| Refractive_Index: | 1.648 |
| Vapor_Pressure: | 5.3E-11mmHg at 25°C |
| MF: | C18H24O4 |
| Exact_Mass: | 304.16700 |
| LogP: | 2.28560 |
| Bolling_Point: | 504.6ºC at 760 mmHg |
| Density: | 1.334 g/cm3 |
| PSA: | 80.92000 |
| Flash_Point: | 238.4ºC |
| Symbol: | GHS08 |
|---|---|
| Risk_Statements(EU): | R40 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P281 |
| Safety_Statements: | H351 |
