![(2S)-4-methyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid (CAS: 24959-68-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0774430.png "(2S)-4-methyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid chemical structure")
(2S)-4-methyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid
Catalog No: FT-0774430
CAS No: 24959-68-0
- Chemical Name: (2S)-4-methyl-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid
- Molecular Formula: C17H24N2O5
- Molecular Weight: 336.4
- InChI Key: YRQTWFBFEXBEQX-JSGCOSHPSA-N
- InChI: InChI=1S/C17H24N2O5/c1-11(2)9-14(16(21)22)19-15(20)12(3)18-17(23)24-10-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3,(H,18,23)(H,19,20)(H,21,22)/t12-,14-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | N/A |
|---|---|
| CAS: | 24959-68-0 |
| MF: | C17H24N2O5 |
| Density: | N/A |
| Melting_Point: | N/A |
| Product_Name: | Z-Ala-Leu-OH |
| Flash_Point: | N/A |
| FW: | 336.38300 |
| Exact_Mass: | 336.16900 |
|---|---|
| MF: | C17H24N2O5 |
| LogP: | 2.69860 |
| PSA: | 104.73000 |
| FW: | 336.38300 |
| HS_Code: | 2924299090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
O-(a-L-Idopyranosyluronic Acid 2-Sulfate-(1-4)-2,5-anhydro-Mannitol-6-sulfate
