![(1S,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-ene-4-carbaldehyde (CAS: 18486-69-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0772998.png "(1S,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-ene-4-carbaldehyde chemical structure")
(1S,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-ene-4-carbaldehyde
Catalog No: FT-0772998
CAS No: 18486-69-6
- Chemical Name: (1S,5R)-6,6-dimethylbicyclo[3.1.1]hept-3-ene-4-carbaldehyde
- Molecular Formula: C10H14O
- Molecular Weight: 150.22 g/mol
- InChI Key: KMRMUZKLFIEVAO-IUCAKERBSA-N
- InChI: InChI=1S/C10H14O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,6,8-9H,4-5H2,1-2H3/t8-,9-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 220-221ºC(lit.) |
|---|---|
| CAS: | 18486-69-6 |
| MF: | C10H14O |
| Density: | 0.988 g/mL at 20ºC(lit.) |
| Melting_Point: | N/A |
| Product_Name: | (-)-myrtenal |
| Flash_Point: | 174 °F |
| FW: | 150.21800 |
| Density: | 0.988 g/mL at 20ºC(lit.) |
|---|---|
| MF: | C10H14O |
| LogP: | 2.17770 |
| Exact_Mass: | 150.10400 |
| Bolling_Point: | 220-221ºC(lit.) |
| Flash_Point: | 174 °F |
| FW: | 150.21800 |
| Refractive_Index: | n20/D 1.504 |
| PSA: | 17.07000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | 23-24/25 |
