4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide;dihydrochloride
Catalog No: FT-0771389
CAS No: 129830-38-2
- Chemical Name: 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide;dihydrochloride
- Molecular Formula: C14H23Cl2N3O
- Molecular Weight: 320.3
- InChI Key: IDDDVXIUIXWAGJ-DDSAHXNVSA-N
- InChI: InChI=1S/C14H21N3O.2ClH/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13;;/h6-12H,2-5,15H2,1H3,(H,16,17,18);2*1H/t10-,11?,12?;;/m1../s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 129830-38-2 |
|---|---|
| MF: | C14H23Cl2N3O |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | Y-27632 2HCl |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 320.258 |
| Exact_Mass: | 319.121826 |
|---|---|
| MF: | C14H23Cl2N3O |
| LogP: | 4.55100 |
| PSA: | 68.01000 |
| FW: | 320.258 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Safety_Statements: | H302 + H312 + H332 |
| Warning_Statement: | P261-P280-P301 + P312 + P330 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)