![(3aR,6aS)-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one (CAS: 128946-78-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0770642.png "(3aR,6aS)-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one chemical structure")
(3aR,6aS)-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one
Catalog No: FT-0770642
CAS No: 128946-78-1
- Chemical Name: (3aR,6aS)-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one
- Molecular Formula: C7H8O2
- Molecular Weight: 124.14
- InChI Key: XYRFGFRTVXZAIU-PHDIDXHHSA-N
- InChI: InChI=1S/C7H8O2/c8-7-6-3-1-2-5(6)4-9-7/h1-2,5-6H,3-4H2/t5-,6-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 263.139ºC at 760 mmHg |
|---|---|
| CAS: | 128946-78-1 |
| MF: | C7H8O2 |
| Density: | 1.196g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | (3aR,6aS)-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
| Flash_Point: | 104.019ºC |
| FW: | 124.13700 |
| Bolling_Point: | 263.139ºC at 760 mmHg |
|---|---|
| Density: | 1.196g/cm3 |
| MF: | C7H8O2 |
| LogP: | 0.73550 |
| Exact_Mass: | 124.05200 |
| Vapor_Pressure: | 0.01mmHg at 25°C |
| Flash_Point: | 104.019ºC |
| FW: | 124.13700 |
| Refractive_Index: | 1.522 |
| PSA: | 26.30000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves |
|---|---|
| RIDADR: | NONH for all modes of transport |
