2-methyl-6-(2-phenylethynyl)pyridine;hydrochloride
Catalog No: FT-0762070
CAS No: 219911-35-0
- Chemical Name: 2-methyl-6-(2-phenylethynyl)pyridine;hydrochloride
- Molecular Formula: C14H12ClN
- Molecular Weight: 229.7
- InChI Key: PKDHDJBNEKXCBI-UHFFFAOYSA-N
- InChI: InChI=1S/C14H11N.ClH/c1-12-6-5-9-14(15-12)11-10-13-7-3-2-4-8-13;/h2-9H,1H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 229.705 |
| CAS: | 219911-35-0 |
| MF: | C14H12ClN |
| Flash_Point: | 144.8ºC |
| Product_Name: | MPEP (Hydrochloride) |
| Bolling_Point: | 336.3ºC at 760mmHg |
| Density: | 1.1g/cm3 |
| FW: | 229.705 |
|---|---|
| Refractive_Index: | 1.614 |
| Vapor_Pressure: | 0.000221mmHg at 25°C |
| MF: | C14H12ClN |
| Exact_Mass: | 229.065826 |
| LogP: | 3.59180 |
| Bolling_Point: | 336.3ºC at 760mmHg |
| Density: | 1.1g/cm3 |
| PSA: | 12.89000 |
| Flash_Point: | 144.8ºC |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2933399090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)