3-methylquinolin-2-amine
Catalog No: FT-0749726
CAS No: 74844-99-8
- Chemical Name: 3-methylquinolin-2-amine
- Molecular Formula: C10H10N2
- Molecular Weight: 158.2
- InChI Key: NCZOVCDTUUZEEA-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10N2/c1-7-6-8-4-2-3-5-9(8)12-10(7)11/h2-6H,1H3,(H2,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 74844-99-8 |
| Flash_Point: | 170.7ºC |
| Product_Name: | 3-methylquinolin-2-amine |
| Bolling_Point: | 316ºC at 760 mmHg |
| FW: | 158.20000 |
| Melting_Point: | N/A |
| MF: | C10H10N2 |
| Density: | 1.169 g/cm3 |
| FW: | 158.20000 |
|---|---|
| Refractive_Index: | 1.682 |
| MF: | C10H10N2 |
| Exact_Mass: | 158.08400 |
| LogP: | 2.70660 |
| Bolling_Point: | 316ºC at 760 mmHg |
| Density: | 1.169 g/cm3 |
| PSA: | 38.91000 |
| Flash_Point: | 170.7ºC |
| Symbol: | GHS05, GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| HS_Code: | 2933499090 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)