4-[(2-fluorophenyl)methoxy]benzoic acid
Catalog No: FT-0749632
CAS No: 405-24-3
- Molecular Formula: 246.23
- Formula Weight: C14H11FO3
- Inchl Key: PKWADBDVMROXJB-UHFFFAOYSA-N
- Inchl: InChI=1S/C14H11FO3/c15-13-4-2-1-3-11(13)9-18-12-7-5-10(6-8-12)14(16)17/h1-8H,9H2,(H,16,17)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 405-24-3 |
|---|---|
| MF: | C14H11FO3 |
| Density: | 1.289g/cm3 |
| Flash_Point: | 193.4ºC |
| Melting_Point: | N/A |
| Product_Name: | 4-[(2-Fluorobenzyl)oxy]benzoic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 396.1ºC at 760 mmHg |
| FW: | 246.23400 |
| Bolling_Point: | 396.1ºC at 760 mmHg |
|---|---|
| Density: | 1.289g/cm3 |
| MF: | C14H11FO3 |
| LogP: | 3.10290 |
| Exact_Mass: | 246.06900 |
| Vapor_Pressure: | 5.5E-07mmHg at 25°C |
| Flash_Point: | 193.4ºC |
| FW: | 246.23400 |
| Refractive_Index: | 1.589 |
| PSA: | 46.53000 |
| Safety_Statements: | H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2918990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)