![4,6-dimethylfuro[2,3-d]pyrimidin-2-amine (CAS: 22727-43-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0748833.png "4,6-dimethylfuro[2,3-d]pyrimidin-2-amine chemical structure")
4,6-dimethylfuro[2,3-d]pyrimidin-2-amine
Catalog No: FT-0748833
CAS No: 22727-43-1
- Chemical Name: 4,6-dimethylfuro[2,3-d]pyrimidin-2-amine
- Molecular Formula: C8H9N3O
- Molecular Weight: 163.18
- InChI Key: MSEVJFYMGKQFNO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9N3O/c1-4-3-6-5(2)10-8(9)11-7(6)12-4/h3H,1-2H3,(H2,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 22727-43-1 |
|---|---|
| MF: | C8H9N3O |
| Density: | 1.278g/cm3 |
| Flash_Point: | 167.8ºC |
| Melting_Point: | N/A |
| Product_Name: | 4,6-dimethylfuro[2,3-d]pyrimidin-2-amine |
| Symbol: | GHS07 |
| Bolling_Point: | 353.8ºC at 760 mmHg |
| FW: | 163.17700 |
| Bolling_Point: | 353.8ºC at 760 mmHg |
|---|---|
| Density: | 1.278g/cm3 |
| MF: | C8H9N3O |
| LogP: | 2.00300 |
| Exact_Mass: | 163.07500 |
| Vapor_Pressure: | 3.49E-05mmHg at 25°C |
| Flash_Point: | 167.8ºC |
| FW: | 163.17700 |
| Refractive_Index: | 1.648 |
| PSA: | 64.94000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
![tert-butyl N-[6-[(2-chloroacetyl)amino]hexyl]carbamate (CAS: 201282-04-4) - Related Chemical Product](/static/img/prod_pic/FT-0770278.png "tert-butyl N-[6-[(2-chloroacetyl)amino]hexyl]carbamate chemical structure")
