4-(4-formylphenoxy)benzaldehyde
Catalog No: FT-0747562
CAS No: 2215-76-1
- Chemical Name: 4-(4-formylphenoxy)benzaldehyde
- Molecular Formula: C14H10O3
- Molecular Weight: 226.23
- InChI Key: GXZZHLULZRMUQC-UHFFFAOYSA-N
- InChI: InChI=1S/C14H10O3/c15-9-11-1-5-13(6-2-11)17-14-7-3-12(10-16)4-8-14/h1-10H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 2215-76-1 |
|---|---|
| MF: | C14H10O3 |
| Density: | 1.233g/cm3 |
| Flash_Point: | 173.1ºC |
| Melting_Point: | 63-67ºC |
| Product_Name: | 4-(4-Formylphenoxy)benzaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | 386ºC at 760 mmHg |
| FW: | 226.22700 |
| Bolling_Point: | 386ºC at 760 mmHg |
|---|---|
| Density: | 1.233g/cm3 |
| MF: | C14H10O3 |
| LogP: | 3.10390 |
| Melting_Point: | 63-67ºC |
| Exact_Mass: | 226.06300 |
| Vapor_Pressure: | 3.66E-06mmHg at 25°C |
| Flash_Point: | 173.1ºC |
| FW: | 226.22700 |
| Refractive_Index: | 1.641 |
| PSA: | 43.37000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26-36/37 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2912299000 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 22-36-43 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)