![6-bromofuro[3,2-b]pyridine-2-carbaldehyde (CAS: 1171920-28-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0746633.png "6-bromofuro[3,2-b]pyridine-2-carbaldehyde chemical structure")
6-bromofuro[3,2-b]pyridine-2-carbaldehyde
Catalog No: FT-0746633
CAS No: 1171920-28-7
- Chemical Name: 6-bromofuro[3,2-b]pyridine-2-carbaldehyde
- Molecular Formula: C8H4BrNO2
- Molecular Weight: 226.03
- InChI Key: GKQNDTWNODMNSB-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4BrNO2/c9-5-1-8-7(10-3-5)2-6(4-11)12-8/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1171920-28-7 |
|---|---|
| MF: | C8H4BrNO2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-Bromofuro[3,2-b]pyridine-2-carbaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 226.02700 |
| Exact_Mass: | 224.94300 |
|---|---|
| MF: | C8H4BrNO2 |
| LogP: | 2.40280 |
| PSA: | 43.10000 |
| FW: | 226.02700 |
| Safety_Statements: | H302-H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
