![(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CAS: 439692-51-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0744066.png "(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazine chemical structure")
(6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazine
Catalog No: FT-0744066
CAS No: 439692-51-0
- Chemical Name: (6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazine
- Molecular Formula: C8H10N4S
- Molecular Weight: 194.26
- InChI Key: BNTVYPPAVREZHM-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10N4S/c1-2-5-3-6-7(12-9)10-4-11-8(6)13-5/h3-4H,2,9H2,1H3,(H,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 439692-51-0 |
|---|---|
| MF: | C8H10N4S |
| Density: | 1.398g/cm3 |
| Flash_Point: | 202.9ºC |
| Melting_Point: | N/A |
| Product_Name: | (6-ethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| Symbol: | GHS07 |
| Bolling_Point: | 411.9ºC at 760 mmHg |
| FW: | 194.25700 |
| Density: | 1.398g/cm3 |
|---|---|
| MF: | C8H10N4S |
| LogP: | 2.31260 |
| Exact_Mass: | 194.06300 |
| Bolling_Point: | 411.9ºC at 760 mmHg |
| Flash_Point: | 202.9ºC |
| FW: | 194.25700 |
| Refractive_Index: | 1.752 |
| PSA: | 92.07000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
